C35H32N4O8 — CID 15115674
[(2R,3R,4S,5R)-5-(6-methoxypurin-9-yl)-3,4-bis[(2-phenylacetyl)oxy]oxolan-2-yl]methyl 2-phenylacetate (PubChem CID 15115674) has the molecular formula C35H32N4O8 and a molecular weight of 636.66 g/mol. Its IUPAC name is [(2R,3R,4S,5R)-5-(6-methoxypurin-9-yl)-3,4-bis[(2-phenylacetyl)oxy]oxolan-2-yl]methyl 2-phenylacetate.
| Compound Name | [(2R,3R,4S,5R)-5-(6-methoxypurin-9-yl)-3,4-bis[(2-phenylacetyl)oxy]oxolan-2-yl]methyl 2-phenylacetate |
|---|---|
| PubChem CID | 15115674 |
| Molecular Formula | C35H32N4O8 |
| Molecular Weight | 636.66 g/mol |
| Exact Mass | 636.22 |
| IUPAC Name | [(2R,3R,4S,5R)-5-(6-methoxypurin-9-yl)-3,4-bis[(2-phenylacetyl)oxy]oxolan-2-yl]methyl 2-phenylacetate |
| SMILES | COc1ncnc2c1ncn2[C@@H]1O[C@H](COC(=O)Cc2ccccc2)[C@@H](OC(=O)Cc2ccccc2)[C@@H]1OC(=O)Cc1ccccc1 |
| InChI | InChI=1S/C35H32N4O8/c1-43-34-30-33(36-21-37-34)39(22-38-30)35-32(47-29(42)19-25-15-9-4-10-16-25)31(46-28(41)18-24-13-7-3-8-14-24)26(45-35)20-44-27(40)17-23-11-5-2-6-12-23/h2-16,21-22,26,31-32,35H,17-20H2,1H3/t26-,31-,32+,35-/m1/s1 |
| InChIKey | MMUAPDHSVGDEOR-HFZAYPMRSA-N |
| XLogP | 3.83 |
| TPSA | 140.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.66 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|