C17H14N6O2S — CID 11079068
[(2R,3R)-2-(6-benzamidopurin-9-yl)oxolan-3-yl] thiocyanate (PubChem CID 11079068) has the molecular formula C17H14N6O2S and a molecular weight of 366.41 g/mol. Its IUPAC name is [(2R,3R)-2-(6-benzamidopurin-9-yl)oxolan-3-yl] thiocyanate.
| Compound Name | [(2R,3R)-2-(6-benzamidopurin-9-yl)oxolan-3-yl] thiocyanate |
|---|---|
| PubChem CID | 11079068 |
| Molecular Formula | C17H14N6O2S |
| Molecular Weight | 366.41 g/mol |
| Exact Mass | 366.09 |
| IUPAC Name | [(2R,3R)-2-(6-benzamidopurin-9-yl)oxolan-3-yl] thiocyanate |
| SMILES | N#CS[C@@H]1CCO[C@H]1n1cnc2c(NC(=O)c3ccccc3)ncnc21 |
| InChI | InChI=1S/C17H14N6O2S/c18-8-26-12-6-7-25-17(12)23-10-21-13-14(19-9-20-15(13)23)22-16(24)11-4-2-1-3-5-11/h1-5,9-10,12,17H,6-7H2,(H,19,20,22,24)/t12-,17-/m1/s1 |
| InChIKey | CXCDHCDMARRUEZ-SJKOYZFVSA-N |
| XLogP | 2.58 |
| TPSA | 105.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.41 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|