C24H43N6O13P3 — CID 154966653
[[5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] [6-(cyclooctylamino)hexoxy-hydroxyphosphoryl] hydrogen phosphate (PubChem CID 154966653) has the molecular formula C24H43N6O13P3 and a molecular weight of 716.56 g/mol. Its IUPAC name is [[5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] [6-(cyclooctylamino)hexoxy-hydroxyphosphoryl] hydrogen phosphate.
| Compound Name | [[5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] [6-(cyclooctylamino)hexoxy-hydroxyphosphoryl] hydrogen phosphate |
|---|---|
| PubChem CID | 154966653 |
| Molecular Formula | C24H43N6O13P3 |
| Molecular Weight | 716.56 g/mol |
| Exact Mass | 716.21 |
| IUPAC Name | [[5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] [6-(cyclooctylamino)hexoxy-hydroxyphosphoryl] hydrogen phosphate |
| SMILES | Nc1ncnc2c1ncn2C1OC(COP(=O)(O)OP(=O)(O)OP(=O)(O)OCCCCCCNC2CCCCCCC2)C(O)C1O |
| InChI | InChI=1S/C24H43N6O13P3/c25-22-19-23(28-15-27-22)30(16-29-19)24-21(32)20(31)18(41-24)14-40-45(35,36)43-46(37,38)42-44(33,34)39-13-9-5-4-8-12-26-17-10-6-2-1-3-7-11-17/h15-18,20-21,24,26,31-32H,1-14H2,(H,33,34)(H,35,36)(H,37,38)(H2,25,27,28) |
| InChIKey | PSZCMJFUGGHPMT-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 280.16 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 46 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 716.56 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|