C20H24N7O9P — CID 24769532
2-[[[(2R,3R,4S,5R)-3,4-dihydroxy-5-[6-(phenylcarbamoylamino)purin-9-yl]oxolan-2-yl]methoxy-hydroxyphosphoryl]methylamino]acetic acid (PubChem CID 24769532) has the molecular formula C20H24N7O9P and a molecular weight of 537.43 g/mol. Its IUPAC name is 2-[[[(2R,3R,4S,5R)-3,4-dihydroxy-5-[6-(phenylcarbamoylamino)purin-9-yl]oxolan-2-yl]methoxy-hydroxyphosphoryl]methylamino]acetic acid.
| Compound Name | 2-[[[(2R,3R,4S,5R)-3,4-dihydroxy-5-[6-(phenylcarbamoylamino)purin-9-yl]oxolan-2-yl]methoxy-hydroxyphosphoryl]methylamino]acetic acid |
|---|---|
| PubChem CID | 24769532 |
| Molecular Formula | C20H24N7O9P |
| Molecular Weight | 537.43 g/mol |
| Exact Mass | 537.14 |
| IUPAC Name | 2-[[[(2R,3R,4S,5R)-3,4-dihydroxy-5-[6-(phenylcarbamoylamino)purin-9-yl]oxolan-2-yl]methoxy-hydroxyphosphoryl]methylamino]acetic acid |
| SMILES | O=C(O)CNCP(=O)(O)OC[C@H]1O[C@@H](n2cnc3c(NC(=O)Nc4ccccc4)ncnc32)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C20H24N7O9P/c28-13(29)6-21-10-37(33,34)35-7-12-15(30)16(31)19(36-12)27-9-24-14-17(22-8-23-18(14)27)26-20(32)25-11-4-2-1-3-5-11/h1-5,8-9,12,15-16,19,21,30-31H,6-7,10H2,(H,28,29)(H,33,34)(H2,22,23,25,26,32)/t12-,15+,16+,19-/m1/s1 |
| InChIKey | VJDAFWQRKWIYGA-XXHPDZBISA-N |
| XLogP | -0.08 |
| TPSA | 230.28 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.43 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|