C13H19N6O8P — CID 123723936
[1-[[5-(6-aminopurin-9-yl)-3-hydroxy-4-methyloxolan-2-yl]methoxy]-2-(hydroxyamino)-2-oxoethyl]phosphonic acid (PubChem CID 123723936) has the molecular formula C13H19N6O8P and a molecular weight of 418.30 g/mol. Its IUPAC name is [1-[[5-(6-aminopurin-9-yl)-3-hydroxy-4-methyloxolan-2-yl]methoxy]-2-(hydroxyamino)-2-oxoethyl]phosphonic acid.
| Compound Name | [1-[[5-(6-aminopurin-9-yl)-3-hydroxy-4-methyloxolan-2-yl]methoxy]-2-(hydroxyamino)-2-oxoethyl]phosphonic acid |
|---|---|
| PubChem CID | 123723936 |
| Molecular Formula | C13H19N6O8P |
| Molecular Weight | 418.30 g/mol |
| Exact Mass | 418.10 |
| IUPAC Name | [1-[[5-(6-aminopurin-9-yl)-3-hydroxy-4-methyloxolan-2-yl]methoxy]-2-(hydroxyamino)-2-oxoethyl]phosphonic acid |
| SMILES | CC1C(O)C(COC(C(=O)NO)P(=O)(O)O)OC1n1cnc2c(N)ncnc21 |
| InChI | InChI=1S/C13H19N6O8P/c1-5-8(20)6(2-26-13(11(21)18-22)28(23,24)25)27-12(5)19-4-17-7-9(14)15-3-16-10(7)19/h3-6,8,12-13,20,22H,2H2,1H3,(H,18,21)(H2,14,15,16)(H2,23,24,25) |
| InChIKey | GADKCAPGGSQPPI-UHFFFAOYSA-N |
| XLogP | -1.67 |
| TPSA | 215.17 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.30 |
| LogP ≤ 5 | -1.67 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|