C10H13F2N3O2S — CID 123547254
4-amino-5-fluoro-1-[3-fluoro-5-(hydroxymethyl)-3-methyloxolan-2-yl]pyrimidine-2-thione (PubChem CID 123547254) has the molecular formula C10H13F2N3O2S and a molecular weight of 277.30 g/mol. Its IUPAC name is 4-amino-5-fluoro-1-[3-fluoro-5-(hydroxymethyl)-3-methyloxolan-2-yl]pyrimidine-2-thione.
| Compound Name | 4-amino-5-fluoro-1-[3-fluoro-5-(hydroxymethyl)-3-methyloxolan-2-yl]pyrimidine-2-thione |
|---|---|
| PubChem CID | 123547254 |
| Molecular Formula | C10H13F2N3O2S |
| Molecular Weight | 277.30 g/mol |
| Exact Mass | 277.07 |
| IUPAC Name | 4-amino-5-fluoro-1-[3-fluoro-5-(hydroxymethyl)-3-methyloxolan-2-yl]pyrimidine-2-thione |
| SMILES | CC1(F)CC(CO)OC1n1cc(F)c(N)nc1=S |
| InChI | InChI=1S/C10H13F2N3O2S/c1-10(12)2-5(4-16)17-8(10)15-3-6(11)7(13)14-9(15)18/h3,5,8,16H,2,4H2,1H3,(H2,13,14,18) |
| InChIKey | ATBWOCXMOJQMDW-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 73.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.30 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|