C28H37N4O9P — CID 161183176
butyl (2S)-3-[[(4R,5R)-5-hydroxy-8-(6-methoxy-2-methylpurin-9-yl)-1,7-dioxaspiro[3.4]octan-6-yl]methoxy-phenoxyphosphoryl]-2-methylpropanoate (PubChem CID 161183176) has the molecular formula C28H37N4O9P and a molecular weight of 604.60 g/mol. Its IUPAC name is butyl (2S)-3-[[(4R,5R)-5-hydroxy-8-(6-methoxy-2-methylpurin-9-yl)-1,7-dioxaspiro[3.4]octan-6-yl]methoxy-phenoxyphosphoryl]-2-methylpropanoate.
| Compound Name | butyl (2S)-3-[[(4R,5R)-5-hydroxy-8-(6-methoxy-2-methylpurin-9-yl)-1,7-dioxaspiro[3.4]octan-6-yl]methoxy-phenoxyphosphoryl]-2-methylpropanoate |
|---|---|
| PubChem CID | 161183176 |
| Molecular Formula | C28H37N4O9P |
| Molecular Weight | 604.60 g/mol |
| Exact Mass | 604.23 |
| IUPAC Name | butyl (2S)-3-[[(4R,5R)-5-hydroxy-8-(6-methoxy-2-methylpurin-9-yl)-1,7-dioxaspiro[3.4]octan-6-yl]methoxy-phenoxyphosphoryl]-2-methylpropanoate |
| SMILES | CCCCOC(=O)[C@H](C)CP(=O)(OCC1OC(n2cnc3c(OC)nc(C)nc32)[C@@]2(CCO2)[C@@H]1O)Oc1ccccc1 |
| InChI | InChI=1S/C28H37N4O9P/c1-5-6-13-37-26(34)18(2)16-42(35,41-20-10-8-7-9-11-20)39-15-21-23(33)28(12-14-38-28)27(40-21)32-17-29-22-24(32)30-19(3)31-25(22)36-4/h7-11,17-18,21,23,27,33H,5-6,12-16H2,1-4H3/t18-,21?,23-,27?,28-,42?/m1/s1 |
| InChIKey | DGWDWPTYQGTNTC-RWFAKREZSA-N |
| XLogP | 3.83 |
| TPSA | 153.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.60 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|