C26H32ClFN5O7P — CID 158424113
(3S)-4-[[(2R,4S,5R)-4-chloro-5-(2,4-diaminopyrrolo[2,3-d]pyrimidin-7-yl)-4-fluoro-3-hydroxyoxolan-2-yl]methoxy-[2-(3-oxobutyl)phenoxy]phosphoryl]-3-methylbutan-2-one (PubChem CID 158424113) has the molecular formula C26H32ClFN5O7P and a molecular weight of 612.00 g/mol. Its IUPAC name is (3S)-4-[[(2R,4S,5R)-4-chloro-5-(2,4-diaminopyrrolo[2,3-d]pyrimidin-7-yl)-4-fluoro-3-hydroxyoxolan-2-yl]methoxy-[2-(3-oxobutyl)phenoxy]phosphoryl]-3-methylbutan-2-one.
| Compound Name | (3S)-4-[[(2R,4S,5R)-4-chloro-5-(2,4-diaminopyrrolo[2,3-d]pyrimidin-7-yl)-4-fluoro-3-hydroxyoxolan-2-yl]methoxy-[2-(3-oxobutyl)phenoxy]phosphoryl]-3-methylbutan-2-one |
|---|---|
| PubChem CID | 158424113 |
| Molecular Formula | C26H32ClFN5O7P |
| Molecular Weight | 612.00 g/mol |
| Exact Mass | 611.17 |
| IUPAC Name | (3S)-4-[[(2R,4S,5R)-4-chloro-5-(2,4-diaminopyrrolo[2,3-d]pyrimidin-7-yl)-4-fluoro-3-hydroxyoxolan-2-yl]methoxy-[2-(3-oxobutyl)phenoxy]phosphoryl]-3-methylbutan-2-one |
| SMILES | CC(=O)CCc1ccccc1OP(=O)(C[C@@H](C)C(C)=O)OC[C@H]1O[C@@H](n2ccc3c(N)nc(N)nc32)[C@@](F)(Cl)C1O |
| InChI | InChI=1S/C26H32ClFN5O7P/c1-14(16(3)35)13-41(37,40-19-7-5-4-6-17(19)9-8-15(2)34)38-12-20-21(36)26(27,28)24(39-20)33-11-10-18-22(29)31-25(30)32-23(18)33/h4-7,10-11,14,20-21,24,36H,8-9,12-13H2,1-3H3,(H4,29,30,31,32)/t14-,20-,21?,24-,26-,41?/m1/s1 |
| InChIKey | FPBWMLWSSVNCLQ-SOCKWQSASA-N |
| XLogP | 3.79 |
| TPSA | 181.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.00 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|