C25H34N7O8P — CID 90307059
(3S)-3-[[[(3R,4R,5R)-5-(2,6-diaminopurin-9-yl)-3,4-dihydroxy-4-methyloxolan-2-yl]methoxy-[2-(3-oxobutyl)phenoxy]phosphoryl]amino]butan-2-one (PubChem CID 90307059) has the molecular formula C25H34N7O8P and a molecular weight of 591.56 g/mol. Its IUPAC name is (3S)-3-[[[(3R,4R,5R)-5-(2,6-diaminopurin-9-yl)-3,4-dihydroxy-4-methyloxolan-2-yl]methoxy-[2-(3-oxobutyl)phenoxy]phosphoryl]amino]butan-2-one.
| Compound Name | (3S)-3-[[[(3R,4R,5R)-5-(2,6-diaminopurin-9-yl)-3,4-dihydroxy-4-methyloxolan-2-yl]methoxy-[2-(3-oxobutyl)phenoxy]phosphoryl]amino]butan-2-one |
|---|---|
| PubChem CID | 90307059 |
| Molecular Formula | C25H34N7O8P |
| Molecular Weight | 591.56 g/mol |
| Exact Mass | 591.22 |
| IUPAC Name | (3S)-3-[[[(3R,4R,5R)-5-(2,6-diaminopurin-9-yl)-3,4-dihydroxy-4-methyloxolan-2-yl]methoxy-[2-(3-oxobutyl)phenoxy]phosphoryl]amino]butan-2-one |
| SMILES | CC(=O)CCc1ccccc1OP(=O)(N[C@@H](C)C(C)=O)OCC1O[C@@H](n2cnc3c(N)nc(N)nc32)[C@](C)(O)[C@@H]1O |
| InChI | InChI=1S/C25H34N7O8P/c1-13(33)9-10-16-7-5-6-8-17(16)40-41(37,31-14(2)15(3)34)38-11-18-20(35)25(4,36)23(39-18)32-12-28-19-21(26)29-24(27)30-22(19)32/h5-8,12,14,18,20,23,35-36H,9-11H2,1-4H3,(H,31,37)(H4,26,27,29,30)/t14-,18?,20+,23+,25+,41?/m0/s1 |
| InChIKey | LGNPHTUFHPMCGN-SBNJOKCKSA-N |
| XLogP | 1.29 |
| TPSA | 227.03 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.56 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|