C19H22FN7O5 — CID 163889104
[(2R,3R,4R,5R)-5-[2-amino-6-(methylamino)purin-9-yl]-4-fluoro-4-methyl-3-[(4-nitrophenyl)methoxy]oxolan-2-yl]methanol (PubChem CID 163889104) has the molecular formula C19H22FN7O5 and a molecular weight of 447.43 g/mol. Its IUPAC name is [(2R,3R,4R,5R)-5-[2-amino-6-(methylamino)purin-9-yl]-4-fluoro-4-methyl-3-[(4-nitrophenyl)methoxy]oxolan-2-yl]methanol.
| Compound Name | [(2R,3R,4R,5R)-5-[2-amino-6-(methylamino)purin-9-yl]-4-fluoro-4-methyl-3-[(4-nitrophenyl)methoxy]oxolan-2-yl]methanol |
|---|---|
| PubChem CID | 163889104 |
| Molecular Formula | C19H22FN7O5 |
| Molecular Weight | 447.43 g/mol |
| Exact Mass | 447.17 |
| IUPAC Name | [(2R,3R,4R,5R)-5-[2-amino-6-(methylamino)purin-9-yl]-4-fluoro-4-methyl-3-[(4-nitrophenyl)methoxy]oxolan-2-yl]methanol |
| SMILES | CNc1nc(N)nc2c1ncn2[C@@H]1O[C@H](CO)[C@@H](OCc2ccc([N+](=O)[O-])cc2)[C@@]1(C)F |
| InChI | InChI=1S/C19H22FN7O5/c1-19(20)14(31-8-10-3-5-11(6-4-10)27(29)30)12(7-28)32-17(19)26-9-23-13-15(22-2)24-18(21)25-16(13)26/h3-6,9,12,14,17,28H,7-8H2,1-2H3,(H3,21,22,24,25)/t12-,14-,17-,19-/m1/s1 |
| InChIKey | QAAAKQKSRSUYLP-KJMSJTNLSA-N |
| XLogP | 1.56 |
| TPSA | 163.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.43 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|