C19H29FN7O5PS — CID 122532058
propan-2-yl (2S)-2-[[(4aR,6R,7R,7aR)-6-[2-amino-6-(dimethylamino)purin-9-yl]-7-fluoro-7-methyl-2-sulfanylidene-4,4a,6,7a-tetrahydrofuro[3,2-d][1,3,2]dioxaphosphinin-2-yl]amino]propanoate (PubChem CID 122532058) has the molecular formula C19H29FN7O5PS and a molecular weight of 517.52 g/mol. Its IUPAC name is propan-2-yl (2S)-2-[[(4aR,6R,7R,7aR)-6-[2-amino-6-(dimethylamino)purin-9-yl]-7-fluoro-7-methyl-2-sulfanylidene-4,4a,6,7a-tetrahydrofuro[3,2-d][1,3,2]dioxaphosphinin-2-yl]amino]propanoate.
| Compound Name | propan-2-yl (2S)-2-[[(4aR,6R,7R,7aR)-6-[2-amino-6-(dimethylamino)purin-9-yl]-7-fluoro-7-methyl-2-sulfanylidene-4,4a,6,7a-tetrahydrofuro[3,2-d][1,3,2]dioxaphosphinin-2-yl]amino]propanoate |
|---|---|
| PubChem CID | 122532058 |
| Molecular Formula | C19H29FN7O5PS |
| Molecular Weight | 517.52 g/mol |
| Exact Mass | 517.17 |
| IUPAC Name | propan-2-yl (2S)-2-[[(4aR,6R,7R,7aR)-6-[2-amino-6-(dimethylamino)purin-9-yl]-7-fluoro-7-methyl-2-sulfanylidene-4,4a,6,7a-tetrahydrofuro[3,2-d][1,3,2]dioxaphosphinin-2-yl]amino]propanoate |
| SMILES | CC(C)OC(=O)[C@H](C)NP1(=S)OC[C@H]2O[C@@H](n3cnc4c(N(C)C)nc(N)nc43)[C@](C)(F)[C@@H]2O1 |
| InChI | InChI=1S/C19H29FN7O5PS/c1-9(2)30-16(28)10(3)25-33(34)29-7-11-13(32-33)19(4,20)17(31-11)27-8-22-12-14(26(5)6)23-18(21)24-15(12)27/h8-11,13,17H,7H2,1-6H3,(H,25,34)(H2,21,23,24)/t10-,11+,13+,17+,19+,33?/m0/s1 |
| InChIKey | QTDXICIZZOLRCS-OLOZWVTDSA-N |
| XLogP | 1.67 |
| TPSA | 138.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.52 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|