C19H26FN6O7P — CID 149335832
methyl (2S)-2-[[(3R,5R,7R,8S,9S)-9-[(2-amino-6-ethoxypurin-9-yl)methyl]-8-fluoro-8-methyl-5-oxo-4,6,10-trioxa-5λ5-phosphatricyclo[5.3.0.01,3]decan-5-yl]amino]propanoate (PubChem CID 149335832) has the molecular formula C19H26FN6O7P and a molecular weight of 500.42 g/mol. Its IUPAC name is methyl (2S)-2-[[(3R,5R,7R,8S,9S)-9-[(2-amino-6-ethoxypurin-9-yl)methyl]-8-fluoro-8-methyl-5-oxo-4,6,10-trioxa-5λ5-phosphatricyclo[5.3.0.01,3]decan-5-yl]amino]propanoate.
| Compound Name | methyl (2S)-2-[[(3R,5R,7R,8S,9S)-9-[(2-amino-6-ethoxypurin-9-yl)methyl]-8-fluoro-8-methyl-5-oxo-4,6,10-trioxa-5λ5-phosphatricyclo[5.3.0.01,3]decan-5-yl]amino]propanoate |
|---|---|
| PubChem CID | 149335832 |
| Molecular Formula | C19H26FN6O7P |
| Molecular Weight | 500.42 g/mol |
| Exact Mass | 500.16 |
| IUPAC Name | methyl (2S)-2-[[(3R,5R,7R,8S,9S)-9-[(2-amino-6-ethoxypurin-9-yl)methyl]-8-fluoro-8-methyl-5-oxo-4,6,10-trioxa-5λ5-phosphatricyclo[5.3.0.01,3]decan-5-yl]amino]propanoate |
| SMILES | CCOc1nc(N)nc2c1ncn2C[C@@H]1OC23C[C@H]2O[P@](=O)(N[C@@H](C)C(=O)OC)O[C@H]3[C@@]1(C)F |
| InChI | InChI=1S/C19H26FN6O7P/c1-5-30-14-12-13(23-17(21)24-14)26(8-22-12)7-11-18(3,20)16-19(31-11)6-10(19)32-34(28,33-16)25-9(2)15(27)29-4/h8-11,16H,5-7H2,1-4H3,(H,25,28)(H2,21,23,24)/t9-,10+,11-,16-,18-,19?,34+/m0/s1 |
| InChIKey | YDFHROJRRGSKRZ-HELLGHPASA-N |
| XLogP | 1.12 |
| TPSA | 161.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.42 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|