C18H21N2O7PS — CID 156804266
(8-methyl-4H-1,3,2-benzodioxaphosphinin-2-yl)oxymethanol;5-(2-oxo-4-sulfanylidenepyrimidin-1-yl)oxolane-2-carbaldehyde (PubChem CID 156804266) has the molecular formula C18H21N2O7PS and a molecular weight of 440.41 g/mol. Its IUPAC name is (8-methyl-4H-1,3,2-benzodioxaphosphinin-2-yl)oxymethanol;5-(2-oxo-4-sulfanylidenepyrimidin-1-yl)oxolane-2-carbaldehyde.
| Compound Name | (8-methyl-4H-1,3,2-benzodioxaphosphinin-2-yl)oxymethanol;5-(2-oxo-4-sulfanylidenepyrimidin-1-yl)oxolane-2-carbaldehyde |
|---|---|
| PubChem CID | 156804266 |
| Molecular Formula | C18H21N2O7PS |
| Molecular Weight | 440.41 g/mol |
| Exact Mass | 440.08 |
| IUPAC Name | (8-methyl-4H-1,3,2-benzodioxaphosphinin-2-yl)oxymethanol;5-(2-oxo-4-sulfanylidenepyrimidin-1-yl)oxolane-2-carbaldehyde |
| SMILES | Cc1cccc2c1OP(OCO)OC2.O=CC1CCC(n2ccc(=S)[nH]c2=O)O1 |
| InChI | InChI=1S/C9H10N2O3S.C9H11O4P/c12-5-6-1-2-8(14-6)11-4-3-7(15)10-9(11)13;1-7-3-2-4-8-5-11-14(12-6-10)13-9(7)8/h3-6,8H,1-2H2,(H,10,13,15);2-4,10H,5-6H2,1H3 |
| InChIKey | MCEQHOGWWQYEJU-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 112.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.41 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|