C42H40O7 — CID 102493039
(2R,3S,4R)-3,4-bis[(4-methoxyphenyl)methoxy]-2-(trityloxymethyl)-3,4-dihydro-2H-pyran-5-carbaldehyde (PubChem CID 102493039) has the molecular formula C42H40O7 and a molecular weight of 656.78 g/mol. Its IUPAC name is (2R,3S,4R)-3,4-bis[(4-methoxyphenyl)methoxy]-2-(trityloxymethyl)-3,4-dihydro-2H-pyran-5-carbaldehyde.
| Compound Name | (2R,3S,4R)-3,4-bis[(4-methoxyphenyl)methoxy]-2-(trityloxymethyl)-3,4-dihydro-2H-pyran-5-carbaldehyde |
|---|---|
| PubChem CID | 102493039 |
| Molecular Formula | C42H40O7 |
| Molecular Weight | 656.78 g/mol |
| Exact Mass | 656.28 |
| IUPAC Name | (2R,3S,4R)-3,4-bis[(4-methoxyphenyl)methoxy]-2-(trityloxymethyl)-3,4-dihydro-2H-pyran-5-carbaldehyde |
| SMILES | COc1ccc(CO[C@H]2[C@H](OCc3ccc(OC)cc3)C(C=O)=CO[C@@H]2COC(c2ccccc2)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C42H40O7/c1-44-37-22-18-31(19-23-37)27-47-40-33(26-43)29-46-39(41(40)48-28-32-20-24-38(45-2)25-21-32)30-49-42(34-12-6-3-7-13-34,35-14-8-4-9-15-35)36-16-10-5-11-17-36/h3-26,29,39-41H,27-28,30H2,1-2H3/t39-,40-,41-/m1/s1 |
| InChIKey | KYTROJLMFJURKT-MHEUVVKCSA-N |
| XLogP | 7.66 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 656.78 |
| LogP ≤ 5 | 7.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|