C23H34O5Si — CID 10811976
(3R,3aS,6R,7R,7aR)-3-acetyl-7-[tert-butyl(dimethyl)silyl]oxy-6-phenylmethoxy-3a,4,5,6,7,7a-hexahydro-3H-1-benzofuran-2-one (PubChem CID 10811976) has the molecular formula C23H34O5Si and a molecular weight of 418.61 g/mol. Its IUPAC name is (3R,3aS,6R,7R,7aR)-3-acetyl-7-[tert-butyl(dimethyl)silyl]oxy-6-phenylmethoxy-3a,4,5,6,7,7a-hexahydro-3H-1-benzofuran-2-one.
| Compound Name | (3R,3aS,6R,7R,7aR)-3-acetyl-7-[tert-butyl(dimethyl)silyl]oxy-6-phenylmethoxy-3a,4,5,6,7,7a-hexahydro-3H-1-benzofuran-2-one |
|---|---|
| PubChem CID | 10811976 |
| Molecular Formula | C23H34O5Si |
| Molecular Weight | 418.61 g/mol |
| Exact Mass | 418.22 |
| IUPAC Name | (3R,3aS,6R,7R,7aR)-3-acetyl-7-[tert-butyl(dimethyl)silyl]oxy-6-phenylmethoxy-3a,4,5,6,7,7a-hexahydro-3H-1-benzofuran-2-one |
| SMILES | CC(=O)[C@@H]1C(=O)O[C@@H]2[C@H]1CC[C@@H](OCc1ccccc1)[C@H]2O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C23H34O5Si/c1-15(24)19-17-12-13-18(26-14-16-10-8-7-9-11-16)21(20(17)27-22(19)25)28-29(5,6)23(2,3)4/h7-11,17-21H,12-14H2,1-6H3/t17-,18+,19-,20+,21+/m0/s1 |
| InChIKey | VXIJBVRQOCTHKT-QGLKVJOYSA-N |
| XLogP | 4.50 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.61 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|