C23H38O5Si — CID 59127412
ethyl (2R)-2-[(1R)-1-[tert-butyl(dimethyl)silyl]oxy-3-phenylmethoxypropyl]-3-ethyloxirane-2-carboxylate (PubChem CID 59127412) has the molecular formula C23H38O5Si and a molecular weight of 422.64 g/mol. Its IUPAC name is ethyl (2R)-2-[(1R)-1-[tert-butyl(dimethyl)silyl]oxy-3-phenylmethoxypropyl]-3-ethyloxirane-2-carboxylate.
| Compound Name | ethyl (2R)-2-[(1R)-1-[tert-butyl(dimethyl)silyl]oxy-3-phenylmethoxypropyl]-3-ethyloxirane-2-carboxylate |
|---|---|
| PubChem CID | 59127412 |
| Molecular Formula | C23H38O5Si |
| Molecular Weight | 422.64 g/mol |
| Exact Mass | 422.25 |
| IUPAC Name | ethyl (2R)-2-[(1R)-1-[tert-butyl(dimethyl)silyl]oxy-3-phenylmethoxypropyl]-3-ethyloxirane-2-carboxylate |
| SMILES | CCOC(=O)[C@@]1([C@@H](CCOCc2ccccc2)O[Si](C)(C)C(C)(C)C)OC1CC |
| InChI | InChI=1S/C23H38O5Si/c1-8-19-23(27-19,21(24)26-9-2)20(28-29(6,7)22(3,4)5)15-16-25-17-18-13-11-10-12-14-18/h10-14,19-20H,8-9,15-17H2,1-7H3/t19?,20-,23-/m1/s1 |
| InChIKey | HEXXCXLLKMKIQO-CXAYOUKQSA-N |
| XLogP | 5.09 |
| TPSA | 57.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.64 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|