C21H34O5S2Si — CID 11201972
ethyl 2-[(1S,3R)-1-hydroxy-5-phenylmethoxy-3-trimethylsilyloxypentyl]-1,3-dithiolane-2-carboxylate (PubChem CID 11201972) has the molecular formula C21H34O5S2Si and a molecular weight of 458.72 g/mol. Its IUPAC name is ethyl 2-[(1S,3R)-1-hydroxy-5-phenylmethoxy-3-trimethylsilyloxypentyl]-1,3-dithiolane-2-carboxylate.
| Compound Name | ethyl 2-[(1S,3R)-1-hydroxy-5-phenylmethoxy-3-trimethylsilyloxypentyl]-1,3-dithiolane-2-carboxylate |
|---|---|
| PubChem CID | 11201972 |
| Molecular Formula | C21H34O5S2Si |
| Molecular Weight | 458.72 g/mol |
| Exact Mass | 458.16 |
| IUPAC Name | ethyl 2-[(1S,3R)-1-hydroxy-5-phenylmethoxy-3-trimethylsilyloxypentyl]-1,3-dithiolane-2-carboxylate |
| SMILES | CCOC(=O)C1([C@@H](O)C[C@@H](CCOCc2ccccc2)O[Si](C)(C)C)SCCS1 |
| InChI | InChI=1S/C21H34O5S2Si/c1-5-25-20(23)21(27-13-14-28-21)19(22)15-18(26-29(2,3)4)11-12-24-16-17-9-7-6-8-10-17/h6-10,18-19,22H,5,11-16H2,1-4H3/t18-,19+/m1/s1 |
| InChIKey | JPRJPDPFCJFENT-MOPGFXCFSA-N |
| XLogP | 4.30 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.72 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|