C20H30O3 — CID 53344420
[(4R,8R)-8-methyl-6-methylidene-9-phenylmethoxynonan-4-yl] acetate (PubChem CID 53344420) has the molecular formula C20H30O3 and a molecular weight of 318.46 g/mol. Its IUPAC name is [(4R,8R)-8-methyl-6-methylidene-9-phenylmethoxynonan-4-yl] acetate.
| Compound Name | [(4R,8R)-8-methyl-6-methylidene-9-phenylmethoxynonan-4-yl] acetate |
|---|---|
| PubChem CID | 53344420 |
| Molecular Formula | C20H30O3 |
| Molecular Weight | 318.46 g/mol |
| Exact Mass | 318.22 |
| IUPAC Name | [(4R,8R)-8-methyl-6-methylidene-9-phenylmethoxynonan-4-yl] acetate |
| SMILES | C=C(C[C@@H](C)COCc1ccccc1)C[C@@H](CCC)OC(C)=O |
| InChI | InChI=1S/C20H30O3/c1-5-9-20(23-18(4)21)13-16(2)12-17(3)14-22-15-19-10-7-6-8-11-19/h6-8,10-11,17,20H,2,5,9,12-15H2,1,3-4H3/t17-,20-/m1/s1 |
| InChIKey | ICMYWFCFCCCSFM-YLJYHZDGSA-N |
| XLogP | 4.91 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.46 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|