C33H45IOPSi+ — CID 11158546
[(Z,2R,4S)-3-[tert-butyl(dimethyl)silyl]oxy-6-iodo-2,4-dimethylhept-5-enyl]-triphenylphosphanium (PubChem CID 11158546) has the molecular formula C33H45IOPSi+ and a molecular weight of 643.69 g/mol. Its IUPAC name is [(Z,2R,4S)-3-[tert-butyl(dimethyl)silyl]oxy-6-iodo-2,4-dimethylhept-5-enyl]-triphenylphosphanium.
| Compound Name | [(Z,2R,4S)-3-[tert-butyl(dimethyl)silyl]oxy-6-iodo-2,4-dimethylhept-5-enyl]-triphenylphosphanium |
|---|---|
| PubChem CID | 11158546 |
| Molecular Formula | C33H45IOPSi+ |
| Molecular Weight | 643.69 g/mol |
| Exact Mass | 643.20 |
| IUPAC Name | [(Z,2R,4S)-3-[tert-butyl(dimethyl)silyl]oxy-6-iodo-2,4-dimethylhept-5-enyl]-triphenylphosphanium |
| SMILES | C/C(I)=C/[C@H](C)C(O[Si](C)(C)C(C)(C)C)[C@@H](C)C[P+](c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C33H45IOPSi/c1-26(24-28(3)34)32(35-37(7,8)33(4,5)6)27(2)25-36(29-18-12-9-13-19-29,30-20-14-10-15-21-30)31-22-16-11-17-23-31/h9-24,26-27,32H,25H2,1-8H3/q+1/b28-24-/t26-,27-,32?/m0/s1 |
| InChIKey | TZXQXZPWUAFIPL-PEQLPZBUSA-N |
| XLogP | 8.98 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 643.69 |
| LogP ≤ 5 | 8.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|