C26H29IOP+ — CID 89073367
[(Z,3S,4S)-3-hydroxy-6-iodo-4-methylhept-5-enyl]-triphenylphosphanium (PubChem CID 89073367) has the molecular formula C26H29IOP+ and a molecular weight of 515.40 g/mol. Its IUPAC name is [(Z,3S,4S)-3-hydroxy-6-iodo-4-methylhept-5-enyl]-triphenylphosphanium.
| Compound Name | [(Z,3S,4S)-3-hydroxy-6-iodo-4-methylhept-5-enyl]-triphenylphosphanium |
|---|---|
| PubChem CID | 89073367 |
| Molecular Formula | C26H29IOP+ |
| Molecular Weight | 515.40 g/mol |
| Exact Mass | 515.10 |
| IUPAC Name | [(Z,3S,4S)-3-hydroxy-6-iodo-4-methylhept-5-enyl]-triphenylphosphanium |
| SMILES | C/C(I)=C/[C@H](C)[C@@H](O)CC[P+](c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C26H29IOP/c1-21(20-22(2)27)26(28)18-19-29(23-12-6-3-7-13-23,24-14-8-4-9-15-24)25-16-10-5-11-17-25/h3-17,20-21,26,28H,18-19H2,1-2H3/q+1/b22-20-/t21-,26-/m0/s1 |
| InChIKey | WAGXHLDZYZTQMR-PGQHJMINSA-N |
| XLogP | 5.71 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.40 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|