C26H30O2P+ — CID 86733262
(5-carboxy-3,4-dimethylpentyl)-triphenylphosphanium (PubChem CID 86733262) has the molecular formula C26H30O2P+ and a molecular weight of 405.50 g/mol. Its IUPAC name is (5-carboxy-3,4-dimethylpentyl)-triphenylphosphanium.
| Compound Name | (5-carboxy-3,4-dimethylpentyl)-triphenylphosphanium |
|---|---|
| PubChem CID | 86733262 |
| Molecular Formula | C26H30O2P+ |
| Molecular Weight | 405.50 g/mol |
| Exact Mass | 405.20 |
| IUPAC Name | (5-carboxy-3,4-dimethylpentyl)-triphenylphosphanium |
| SMILES | CC(CC[P+](c1ccccc1)(c1ccccc1)c1ccccc1)C(C)CC(=O)O |
| InChI | InChI=1S/C26H29O2P/c1-21(22(2)20-26(27)28)18-19-29(23-12-6-3-7-13-23,24-14-8-4-9-15-24)25-16-10-5-11-17-25/h3-17,21-22H,18-20H2,1-2H3/p+1 |
| InChIKey | YBNVQXRFCJEPHC-UHFFFAOYSA-O |
| XLogP | 5.12 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.50 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|