C13H17F4NO3 — CID 103474001
1-(5-propan-2-yloxy-3-pyridinyl)-2-(2,2,3,3-tetrafluoropropoxy)ethanol (PubChem CID 103474001) has the molecular formula C13H17F4NO3 and a molecular weight of 311.28 g/mol. Its IUPAC name is 1-(5-propan-2-yloxy-3-pyridinyl)-2-(2,2,3,3-tetrafluoropropoxy)ethanol.
| Compound Name | 1-(5-propan-2-yloxy-3-pyridinyl)-2-(2,2,3,3-tetrafluoropropoxy)ethanol |
|---|---|
| PubChem CID | 103474001 |
| Molecular Formula | C13H17F4NO3 |
| Molecular Weight | 311.28 g/mol |
| Exact Mass | 311.11 |
| IUPAC Name | 1-(5-propan-2-yloxy-3-pyridinyl)-2-(2,2,3,3-tetrafluoropropoxy)ethanol |
| SMILES | CC(C)Oc1cncc(C(O)COCC(F)(F)C(F)F)c1 |
| InChI | InChI=1S/C13H17F4NO3/c1-8(2)21-10-3-9(4-18-5-10)11(19)6-20-7-13(16,17)12(14)15/h3-5,8,11-12,19H,6-7H2,1-2H3 |
| InChIKey | FFTSMGXQKPBHQU-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 51.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.28 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|