C10H10Cl2F3NO2 — CID 82722510
1-(2,5-dichlorophenyl)-2-(2,2,2-trifluoroethoxyamino)ethanol (PubChem CID 82722510) has the molecular formula C10H10Cl2F3NO2 and a molecular weight of 304.10 g/mol. Its IUPAC name is 1-(2,5-dichlorophenyl)-2-(2,2,2-trifluoroethoxyamino)ethanol.
| Compound Name | 1-(2,5-dichlorophenyl)-2-(2,2,2-trifluoroethoxyamino)ethanol |
|---|---|
| PubChem CID | 82722510 |
| Molecular Formula | C10H10Cl2F3NO2 |
| Molecular Weight | 304.10 g/mol |
| Exact Mass | 303.00 |
| IUPAC Name | 1-(2,5-dichlorophenyl)-2-(2,2,2-trifluoroethoxyamino)ethanol |
| SMILES | OC(CNOCC(F)(F)F)c1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C10H10Cl2F3NO2/c11-6-1-2-8(12)7(3-6)9(17)4-16-18-5-10(13,14)15/h1-3,9,16-17H,4-5H2 |
| InChIKey | CRRZEEHDNGNXQS-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.10 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|