C12H13ClF4N2O2 — CID 29004297
N-(4-amino-2-chlorophenyl)-3-(2,2,3,3-tetrafluoropropoxy)propanamide (PubChem CID 29004297) has the molecular formula C12H13ClF4N2O2 and a molecular weight of 328.69 g/mol. Its IUPAC name is N-(4-amino-2-chlorophenyl)-3-(2,2,3,3-tetrafluoropropoxy)propanamide.
| Compound Name | N-(4-amino-2-chlorophenyl)-3-(2,2,3,3-tetrafluoropropoxy)propanamide |
|---|---|
| PubChem CID | 29004297 |
| Molecular Formula | C12H13ClF4N2O2 |
| Molecular Weight | 328.69 g/mol |
| Exact Mass | 328.06 |
| IUPAC Name | N-(4-amino-2-chlorophenyl)-3-(2,2,3,3-tetrafluoropropoxy)propanamide |
| SMILES | Nc1ccc(NC(=O)CCOCC(F)(F)C(F)F)c(Cl)c1 |
| InChI | InChI=1S/C12H13ClF4N2O2/c13-8-5-7(18)1-2-9(8)19-10(20)3-4-21-6-12(16,17)11(14)15/h1-2,5,11H,3-4,6,18H2,(H,19,20) |
| InChIKey | JLUGTTIHCUQYKI-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.69 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|