C18H28N2O6 — CID 122585555
[5-(6-hydroxyhexoxy)-2-[(2-methylpropan-2-yl)oxycarbonylamino]phenyl]carbamic acid (PubChem CID 122585555) has the molecular formula C18H28N2O6 and a molecular weight of 368.43 g/mol. Its IUPAC name is [5-(6-hydroxyhexoxy)-2-[(2-methylpropan-2-yl)oxycarbonylamino]phenyl]carbamic acid.
| Compound Name | [5-(6-hydroxyhexoxy)-2-[(2-methylpropan-2-yl)oxycarbonylamino]phenyl]carbamic acid |
|---|---|
| PubChem CID | 122585555 |
| Molecular Formula | C18H28N2O6 |
| Molecular Weight | 368.43 g/mol |
| Exact Mass | 368.19 |
| IUPAC Name | [5-(6-hydroxyhexoxy)-2-[(2-methylpropan-2-yl)oxycarbonylamino]phenyl]carbamic acid |
| SMILES | CC(C)(C)OC(=O)Nc1ccc(OCCCCCCO)cc1NC(=O)O |
| InChI | InChI=1S/C18H28N2O6/c1-18(2,3)26-17(24)20-14-9-8-13(12-15(14)19-16(22)23)25-11-7-5-4-6-10-21/h8-9,12,19,21H,4-7,10-11H2,1-3H3,(H,20,24)(H,22,23) |
| InChIKey | OOZFEKUESGQZHD-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 117.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.43 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|