C14H14FN3O2 — CID 60814898
N-[2-(3-aminoprop-1-ynyl)-4-fluorophenyl]-5-oxopyrrolidine-2-carboxamide (PubChem CID 60814898) has the molecular formula C14H14FN3O2 and a molecular weight of 275.28 g/mol. Its IUPAC name is N-[2-(3-aminoprop-1-ynyl)-4-fluorophenyl]-5-oxopyrrolidine-2-carboxamide.
| Compound Name | N-[2-(3-aminoprop-1-ynyl)-4-fluorophenyl]-5-oxopyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 60814898 |
| Molecular Formula | C14H14FN3O2 |
| Molecular Weight | 275.28 g/mol |
| Exact Mass | 275.11 |
| IUPAC Name | N-[2-(3-aminoprop-1-ynyl)-4-fluorophenyl]-5-oxopyrrolidine-2-carboxamide |
| SMILES | NCC#Cc1cc(F)ccc1NC(=O)C1CCC(=O)N1 |
| InChI | InChI=1S/C14H14FN3O2/c15-10-3-4-11(9(8-10)2-1-7-16)18-14(20)12-5-6-13(19)17-12/h3-4,8,12H,5-7,16H2,(H,17,19)(H,18,20) |
| InChIKey | VUTFOFJBXLAMBE-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.28 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|