C20H15N5O5S — CID 139457094
4-hydroxy-2-[[3-(pyridin-3-ylsulfonylamino)quinoxalin-2-yl]amino]benzoic acid (PubChem CID 139457094) has the molecular formula C20H15N5O5S and a molecular weight of 437.44 g/mol. Its IUPAC name is 4-hydroxy-2-[[3-(pyridin-3-ylsulfonylamino)quinoxalin-2-yl]amino]benzoic acid.
| Compound Name | 4-hydroxy-2-[[3-(pyridin-3-ylsulfonylamino)quinoxalin-2-yl]amino]benzoic acid |
|---|---|
| PubChem CID | 139457094 |
| Molecular Formula | C20H15N5O5S |
| Molecular Weight | 437.44 g/mol |
| Exact Mass | 437.08 |
| IUPAC Name | 4-hydroxy-2-[[3-(pyridin-3-ylsulfonylamino)quinoxalin-2-yl]amino]benzoic acid |
| SMILES | O=C(O)c1ccc(O)cc1Nc1nc2ccccc2nc1NS(=O)(=O)c1cccnc1 |
| InChI | InChI=1S/C20H15N5O5S/c26-12-7-8-14(20(27)28)17(10-12)24-18-19(23-16-6-2-1-5-15(16)22-18)25-31(29,30)13-4-3-9-21-11-13/h1-11,26H,(H,22,24)(H,23,25)(H,27,28) |
| InChIKey | BFRVMEUXTHEANL-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 154.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.44 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |