C21H18N4O4S2 — CID 69052757
2-[[3-(benzenesulfonamido)quinoxalin-2-yl]amino]-5-ethylthiophene-3-carboxylic acid (PubChem CID 69052757) has the molecular formula C21H18N4O4S2 and a molecular weight of 454.53 g/mol. Its IUPAC name is 2-[[3-(benzenesulfonamido)quinoxalin-2-yl]amino]-5-ethylthiophene-3-carboxylic acid.
| Compound Name | 2-[[3-(benzenesulfonamido)quinoxalin-2-yl]amino]-5-ethylthiophene-3-carboxylic acid |
|---|---|
| PubChem CID | 69052757 |
| Molecular Formula | C21H18N4O4S2 |
| Molecular Weight | 454.53 g/mol |
| Exact Mass | 454.08 |
| IUPAC Name | 2-[[3-(benzenesulfonamido)quinoxalin-2-yl]amino]-5-ethylthiophene-3-carboxylic acid |
| SMILES | CCc1cc(C(=O)O)c(Nc2nc3ccccc3nc2NS(=O)(=O)c2ccccc2)s1 |
| InChI | InChI=1S/C21H18N4O4S2/c1-2-13-12-15(21(26)27)20(30-13)24-18-19(23-17-11-7-6-10-16(17)22-18)25-31(28,29)14-8-4-3-5-9-14/h3-12H,2H2,1H3,(H,22,24)(H,23,25)(H,26,27) |
| InChIKey | SWBOOVNKMAUSKM-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 121.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.53 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |