C22H21KN5O4S — CID 68699737
CID 68699737 (PubChem CID 68699737) has the molecular formula C22H21KN5O4S and a molecular weight of 490.61 g/mol.
| Compound Name | CID 68699737 |
|---|---|
| PubChem CID | 68699737 |
| Molecular Formula | C22H21KN5O4S |
| Molecular Weight | 490.61 g/mol |
| Exact Mass | 490.10 |
| IUPAC Name | — |
| SMILES | COc1ccc(CCO)c(Nc2nc3ccccc3nc2NS(=O)(=O)c2cccnc2)c1.[K] |
| InChI | InChI=1S/C22H21N5O4S.K/c1-31-16-9-8-15(10-12-28)20(13-16)26-21-22(25-19-7-3-2-6-18(19)24-21)27-32(29,30)17-5-4-11-23-14-17;/h2-9,11,13-14,28H,10,12H2,1H3,(H,24,26)(H,25,27); |
| InChIKey | KLPPMNXLSFHSMT-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 126.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.61 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |