C23H25N5O4S — CID 163974077
(2E)-N-[3-[2-(2-hydroxyethyl)-5-methoxyanilino]quinoxalin-2-yl]-1-methyliminopenta-2,4-diene-2-sulfonamide (PubChem CID 163974077) has the molecular formula C23H25N5O4S and a molecular weight of 467.55 g/mol. Its IUPAC name is (2E)-N-[3-[2-(2-hydroxyethyl)-5-methoxyanilino]quinoxalin-2-yl]-1-methyliminopenta-2,4-diene-2-sulfonamide.
| Compound Name | (2E)-N-[3-[2-(2-hydroxyethyl)-5-methoxyanilino]quinoxalin-2-yl]-1-methyliminopenta-2,4-diene-2-sulfonamide |
|---|---|
| PubChem CID | 163974077 |
| Molecular Formula | C23H25N5O4S |
| Molecular Weight | 467.55 g/mol |
| Exact Mass | 467.16 |
| IUPAC Name | (2E)-N-[3-[2-(2-hydroxyethyl)-5-methoxyanilino]quinoxalin-2-yl]-1-methyliminopenta-2,4-diene-2-sulfonamide |
| SMILES | C=C/C=C(\C=N\C)S(=O)(=O)Nc1nc2ccccc2nc1Nc1cc(OC)ccc1CCO |
| InChI | InChI=1S/C23H25N5O4S/c1-4-7-18(15-24-2)33(30,31)28-23-22(25-19-8-5-6-9-20(19)26-23)27-21-14-17(32-3)11-10-16(21)12-13-29/h4-11,14-15,29H,1,12-13H2,2-3H3,(H,25,27)(H,26,28)/b18-7+,24-15+ |
| InChIKey | SSNUEJYSLULLKB-SCJVARFRSA-N |
| XLogP | 3.43 |
| TPSA | 125.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.55 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|