C20H24N4O4S — CID 24992801
1-[3-[2-(2-hydroxyethyl)-5-methoxyanilino]quinoxalin-2-yl]propane-1-sulfonamide (PubChem CID 24992801) has the molecular formula C20H24N4O4S and a molecular weight of 416.50 g/mol. Its IUPAC name is 1-[3-[2-(2-hydroxyethyl)-5-methoxyanilino]quinoxalin-2-yl]propane-1-sulfonamide.
| Compound Name | 1-[3-[2-(2-hydroxyethyl)-5-methoxyanilino]quinoxalin-2-yl]propane-1-sulfonamide |
|---|---|
| PubChem CID | 24992801 |
| Molecular Formula | C20H24N4O4S |
| Molecular Weight | 416.50 g/mol |
| Exact Mass | 416.15 |
| IUPAC Name | 1-[3-[2-(2-hydroxyethyl)-5-methoxyanilino]quinoxalin-2-yl]propane-1-sulfonamide |
| SMILES | CCC(c1nc2ccccc2nc1Nc1cc(OC)ccc1CCO)S(N)(=O)=O |
| InChI | InChI=1S/C20H24N4O4S/c1-3-18(29(21,26)27)19-20(23-16-7-5-4-6-15(16)22-19)24-17-12-14(28-2)9-8-13(17)10-11-25/h4-9,12,18,25H,3,10-11H2,1-2H3,(H,23,24)(H2,21,26,27) |
| InChIKey | JRKOWBOJTUXCAR-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 127.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.50 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |