C22H28N4O5S3 — CID 24992143
N-[3-[5-methoxy-2-(2-methylsulfonylethyl)anilino]quinoxalin-2-yl]-3-methylsulfanylpropane-1-sulfonamide (PubChem CID 24992143) has the molecular formula C22H28N4O5S3 and a molecular weight of 524.69 g/mol. Its IUPAC name is N-[3-[5-methoxy-2-(2-methylsulfonylethyl)anilino]quinoxalin-2-yl]-3-methylsulfanylpropane-1-sulfonamide.
| Compound Name | N-[3-[5-methoxy-2-(2-methylsulfonylethyl)anilino]quinoxalin-2-yl]-3-methylsulfanylpropane-1-sulfonamide |
|---|---|
| PubChem CID | 24992143 |
| Molecular Formula | C22H28N4O5S3 |
| Molecular Weight | 524.69 g/mol |
| Exact Mass | 524.12 |
| IUPAC Name | N-[3-[5-methoxy-2-(2-methylsulfonylethyl)anilino]quinoxalin-2-yl]-3-methylsulfanylpropane-1-sulfonamide |
| SMILES | COc1ccc(CCS(C)(=O)=O)c(Nc2nc3ccccc3nc2NS(=O)(=O)CCCSC)c1 |
| InChI | InChI=1S/C22H28N4O5S3/c1-31-17-10-9-16(11-14-33(3,27)28)20(15-17)25-21-22(26-34(29,30)13-6-12-32-2)24-19-8-5-4-7-18(19)23-21/h4-5,7-10,15H,6,11-14H2,1-3H3,(H,23,25)(H,24,26) |
| InChIKey | KSXZHPDAMJGPTK-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 127.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.69 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|