C10H8N2O4S2 — CID 43443006
3-(pyridin-3-ylsulfonylamino)thiophene-2-carboxylic acid (PubChem CID 43443006) has the molecular formula C10H8N2O4S2 and a molecular weight of 284.32 g/mol. Its IUPAC name is 3-(pyridin-3-ylsulfonylamino)thiophene-2-carboxylic acid.
| Compound Name | 3-(pyridin-3-ylsulfonylamino)thiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 43443006 |
| Molecular Formula | C10H8N2O4S2 |
| Molecular Weight | 284.32 g/mol |
| Exact Mass | 283.99 |
| IUPAC Name | 3-(pyridin-3-ylsulfonylamino)thiophene-2-carboxylic acid |
| SMILES | O=C(O)c1sccc1NS(=O)(=O)c1cccnc1 |
| InChI | InChI=1S/C10H8N2O4S2/c13-10(14)9-8(3-5-17-9)12-18(15,16)7-2-1-4-11-6-7/h1-6,12H,(H,13,14) |
| InChIKey | LJSWAPQCZCQHGZ-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 96.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.32 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |