C11H11N3O4S — CID 82880941
2-methyl-4-(pyridin-3-ylsulfonylamino)-1H-pyrrole-3-carboxylic acid (PubChem CID 82880941) has the molecular formula C11H11N3O4S and a molecular weight of 281.29 g/mol. Its IUPAC name is 2-methyl-4-(pyridin-3-ylsulfonylamino)-1H-pyrrole-3-carboxylic acid.
| Compound Name | 2-methyl-4-(pyridin-3-ylsulfonylamino)-1H-pyrrole-3-carboxylic acid |
|---|---|
| PubChem CID | 82880941 |
| Molecular Formula | C11H11N3O4S |
| Molecular Weight | 281.29 g/mol |
| Exact Mass | 281.05 |
| IUPAC Name | 2-methyl-4-(pyridin-3-ylsulfonylamino)-1H-pyrrole-3-carboxylic acid |
| SMILES | Cc1[nH]cc(NS(=O)(=O)c2cccnc2)c1C(=O)O |
| InChI | InChI=1S/C11H11N3O4S/c1-7-10(11(15)16)9(6-13-7)14-19(17,18)8-3-2-4-12-5-8/h2-6,13-14H,1H3,(H,15,16) |
| InChIKey | MLZOAUGRCMMLGM-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 112.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.29 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |