C11H8N2O3S — CID 16773059
3-(pyridine-3-carbonylamino)thiophene-2-carboxylic acid (PubChem CID 16773059) has the molecular formula C11H8N2O3S and a molecular weight of 248.26 g/mol. Its IUPAC name is 3-(pyridine-3-carbonylamino)thiophene-2-carboxylic acid.
| Compound Name | 3-(pyridine-3-carbonylamino)thiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 16773059 |
| Molecular Formula | C11H8N2O3S |
| Molecular Weight | 248.26 g/mol |
| Exact Mass | 248.03 |
| IUPAC Name | 3-(pyridine-3-carbonylamino)thiophene-2-carboxylic acid |
| SMILES | O=C(Nc1ccsc1C(=O)O)c1cccnc1 |
| InChI | InChI=1S/C11H8N2O3S/c14-10(7-2-1-4-12-6-7)13-8-3-5-17-9(8)11(15)16/h1-6H,(H,13,14)(H,15,16) |
| InChIKey | UPOKLRUVGHHTMH-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.26 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |