C12H10N2O3S2 — CID 43171778
3-[(2-methylsulfanylpyridine-3-carbonyl)amino]thiophene-2-carboxylic acid (PubChem CID 43171778) has the molecular formula C12H10N2O3S2 and a molecular weight of 294.36 g/mol. Its IUPAC name is 3-[(2-methylsulfanylpyridine-3-carbonyl)amino]thiophene-2-carboxylic acid.
| Compound Name | 3-[(2-methylsulfanylpyridine-3-carbonyl)amino]thiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 43171778 |
| Molecular Formula | C12H10N2O3S2 |
| Molecular Weight | 294.36 g/mol |
| Exact Mass | 294.01 |
| IUPAC Name | 3-[(2-methylsulfanylpyridine-3-carbonyl)amino]thiophene-2-carboxylic acid |
| SMILES | CSc1ncccc1C(=O)Nc1ccsc1C(=O)O |
| InChI | InChI=1S/C12H10N2O3S2/c1-18-11-7(3-2-5-13-11)10(15)14-8-4-6-19-9(8)12(16)17/h2-6H,1H3,(H,14,15)(H,16,17) |
| InChIKey | PLYBTGYVZFHUPY-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.36 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |