C18H18Cl2N2O2 — CID 58436822
(5E)-5-(3,4-dichlorophenyl)-5-methoxyimino-3-methyl-1-pyridin-3-ylpentan-2-one (PubChem CID 58436822) has the molecular formula C18H18Cl2N2O2 and a molecular weight of 365.26 g/mol. Its IUPAC name is (5E)-5-(3,4-dichlorophenyl)-5-methoxyimino-3-methyl-1-pyridin-3-ylpentan-2-one.
| Compound Name | (5E)-5-(3,4-dichlorophenyl)-5-methoxyimino-3-methyl-1-pyridin-3-ylpentan-2-one |
|---|---|
| PubChem CID | 58436822 |
| Molecular Formula | C18H18Cl2N2O2 |
| Molecular Weight | 365.26 g/mol |
| Exact Mass | 364.07 |
| IUPAC Name | (5E)-5-(3,4-dichlorophenyl)-5-methoxyimino-3-methyl-1-pyridin-3-ylpentan-2-one |
| SMILES | CO/N=C(\CC(C)C(=O)Cc1cccnc1)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C18H18Cl2N2O2/c1-12(18(23)9-13-4-3-7-21-11-13)8-17(22-24-2)14-5-6-15(19)16(20)10-14/h3-7,10-12H,8-9H2,1-2H3/b22-17+ |
| InChIKey | VAGVTDQVLNRDAD-OQKWZONESA-N |
| XLogP | 4.58 |
| TPSA | 51.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.26 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|