C14H17Cl2NO2 — CID 123450309
(1Z)-1-(3,4-dichlorophenyl)-1-methoxyiminoheptan-4-one (PubChem CID 123450309) has the molecular formula C14H17Cl2NO2 and a molecular weight of 302.20 g/mol. Its IUPAC name is (1Z)-1-(3,4-dichlorophenyl)-1-methoxyiminoheptan-4-one.
| Compound Name | (1Z)-1-(3,4-dichlorophenyl)-1-methoxyiminoheptan-4-one |
|---|---|
| PubChem CID | 123450309 |
| Molecular Formula | C14H17Cl2NO2 |
| Molecular Weight | 302.20 g/mol |
| Exact Mass | 301.06 |
| IUPAC Name | (1Z)-1-(3,4-dichlorophenyl)-1-methoxyiminoheptan-4-one |
| SMILES | CCCC(=O)CC/C(=N/OC)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C14H17Cl2NO2/c1-3-4-11(18)6-8-14(17-19-2)10-5-7-12(15)13(16)9-10/h5,7,9H,3-4,6,8H2,1-2H3/b17-14- |
| InChIKey | BGKODLOFOMSQJB-VKAVYKQESA-N |
| XLogP | 4.49 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.20 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|