C17H19ClN4O4S — CID 39945799
N-[2-(3-chloro-2-methylanilino)-2-oxoethyl]-3-(pyridin-3-ylsulfonylamino)propanamide (PubChem CID 39945799) has the molecular formula C17H19ClN4O4S and a molecular weight of 410.88 g/mol. Its IUPAC name is N-[2-(3-chloro-2-methylanilino)-2-oxoethyl]-3-(pyridin-3-ylsulfonylamino)propanamide.
| Compound Name | N-[2-(3-chloro-2-methylanilino)-2-oxoethyl]-3-(pyridin-3-ylsulfonylamino)propanamide |
|---|---|
| PubChem CID | 39945799 |
| Molecular Formula | C17H19ClN4O4S |
| Molecular Weight | 410.88 g/mol |
| Exact Mass | 410.08 |
| IUPAC Name | N-[2-(3-chloro-2-methylanilino)-2-oxoethyl]-3-(pyridin-3-ylsulfonylamino)propanamide |
| SMILES | Cc1c(Cl)cccc1NC(=O)CNC(=O)CCNS(=O)(=O)c1cccnc1 |
| InChI | InChI=1S/C17H19ClN4O4S/c1-12-14(18)5-2-6-15(12)22-17(24)11-20-16(23)7-9-21-27(25,26)13-4-3-8-19-10-13/h2-6,8,10,21H,7,9,11H2,1H3,(H,20,23)(H,22,24) |
| InChIKey | GQDPMMBCOMKBKX-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 117.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.88 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |