C17H17Cl2NO7 — CID 143930178
2-[(2R)-3,4-dihydroxy-5-oxo-2H-furan-2-yl]ethyl (4E)-4-(3,4-dichlorophenyl)-4-methoxyiminobutanoate (PubChem CID 143930178) has the molecular formula C17H17Cl2NO7 and a molecular weight of 418.23 g/mol. Its IUPAC name is 2-[(2R)-3,4-dihydroxy-5-oxo-2H-furan-2-yl]ethyl (4E)-4-(3,4-dichlorophenyl)-4-methoxyiminobutanoate.
| Compound Name | 2-[(2R)-3,4-dihydroxy-5-oxo-2H-furan-2-yl]ethyl (4E)-4-(3,4-dichlorophenyl)-4-methoxyiminobutanoate |
|---|---|
| PubChem CID | 143930178 |
| Molecular Formula | C17H17Cl2NO7 |
| Molecular Weight | 418.23 g/mol |
| Exact Mass | 417.04 |
| IUPAC Name | 2-[(2R)-3,4-dihydroxy-5-oxo-2H-furan-2-yl]ethyl (4E)-4-(3,4-dichlorophenyl)-4-methoxyiminobutanoate |
| SMILES | CO/N=C(\CCC(=O)OCC[C@H]1OC(=O)C(O)=C1O)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C17H17Cl2NO7/c1-25-20-12(9-2-3-10(18)11(19)8-9)4-5-14(21)26-7-6-13-15(22)16(23)17(24)27-13/h2-3,8,13,22-23H,4-7H2,1H3/b20-12+/t13-/m1/s1 |
| InChIKey | DFXIISVDJJFXRF-HMHKGCENSA-N |
| XLogP | 3.31 |
| TPSA | 114.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.23 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|