C16H23Cl2N3O2 — CID 122625626
4-(3,4-dichlorophenyl)-N-[2-(dimethylamino)ethyl]-4-ethoxyiminobutanamide (PubChem CID 122625626) has the molecular formula C16H23Cl2N3O2 and a molecular weight of 360.29 g/mol. Its IUPAC name is 4-(3,4-dichlorophenyl)-N-[2-(dimethylamino)ethyl]-4-ethoxyiminobutanamide.
| Compound Name | 4-(3,4-dichlorophenyl)-N-[2-(dimethylamino)ethyl]-4-ethoxyiminobutanamide |
|---|---|
| PubChem CID | 122625626 |
| Molecular Formula | C16H23Cl2N3O2 |
| Molecular Weight | 360.29 g/mol |
| Exact Mass | 359.12 |
| IUPAC Name | 4-(3,4-dichlorophenyl)-N-[2-(dimethylamino)ethyl]-4-ethoxyiminobutanamide |
| SMILES | CCON=C(CCC(=O)NCCN(C)C)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C16H23Cl2N3O2/c1-4-23-20-15(12-5-6-13(17)14(18)11-12)7-8-16(22)19-9-10-21(2)3/h5-6,11H,4,7-10H2,1-3H3,(H,19,22) |
| InChIKey | URSLWCSLAJSHNG-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 53.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.29 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|