C25H32N4 — CID 56683980
2-(1-adamantyl)-4-(2-pyrrolidin-1-ylethyl)imidazo[1,2-a]benzimidazole (PubChem CID 56683980) has the molecular formula C25H32N4 and a molecular weight of 388.56 g/mol. Its IUPAC name is 2-(1-adamantyl)-4-(2-pyrrolidin-1-ylethyl)imidazo[1,2-a]benzimidazole.
| Compound Name | 2-(1-adamantyl)-4-(2-pyrrolidin-1-ylethyl)imidazo[1,2-a]benzimidazole |
|---|---|
| PubChem CID | 56683980 |
| Molecular Formula | C25H32N4 |
| Molecular Weight | 388.56 g/mol |
| Exact Mass | 388.26 |
| IUPAC Name | 2-(1-adamantyl)-4-(2-pyrrolidin-1-ylethyl)imidazo[1,2-a]benzimidazole |
| SMILES | c1ccc2c(c1)n(CCN1CCCC1)c1nc(C34CC5CC(CC(C5)C3)C4)cn21 |
| InChI | InChI=1S/C25H32N4/c1-2-6-22-21(5-1)28(10-9-27-7-3-4-8-27)24-26-23(17-29(22)24)25-14-18-11-19(15-25)13-20(12-18)16-25/h1-2,5-6,17-20H,3-4,7-16H2 |
| InChIKey | NVFIOJARKNSLGP-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 25.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.56 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |