C21H30N4O3 — CID 66784008
N-(4-methylcyclohexyl)-3-(2-morpholin-4-ylethyl)-2-oxobenzimidazole-1-carboxamide (PubChem CID 66784008) has the molecular formula C21H30N4O3 and a molecular weight of 386.50 g/mol. Its IUPAC name is N-(4-methylcyclohexyl)-3-(2-morpholin-4-ylethyl)-2-oxobenzimidazole-1-carboxamide.
| Compound Name | N-(4-methylcyclohexyl)-3-(2-morpholin-4-ylethyl)-2-oxobenzimidazole-1-carboxamide |
|---|---|
| PubChem CID | 66784008 |
| Molecular Formula | C21H30N4O3 |
| Molecular Weight | 386.50 g/mol |
| Exact Mass | 386.23 |
| IUPAC Name | N-(4-methylcyclohexyl)-3-(2-morpholin-4-ylethyl)-2-oxobenzimidazole-1-carboxamide |
| SMILES | CC1CCC(NC(=O)n2c(=O)n(CCN3CCOCC3)c3ccccc32)CC1 |
| InChI | InChI=1S/C21H30N4O3/c1-16-6-8-17(9-7-16)22-20(26)25-19-5-3-2-4-18(19)24(21(25)27)11-10-23-12-14-28-15-13-23/h2-5,16-17H,6-15H2,1H3,(H,22,26) |
| InChIKey | WDTGFDSLWUVLQQ-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 68.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.50 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |