C21H33N8O3+ — CID 143641847
[(2S)-3,3-dimethyl-2-[[3-(2-morpholin-4-ylethyl)-2-oxobenzimidazole-1-carbonyl]amino]butanimidoyl]-hydrazinylidene-methylazanium (PubChem CID 143641847) has the molecular formula C21H33N8O3+ and a molecular weight of 445.55 g/mol. Its IUPAC name is [(2S)-3,3-dimethyl-2-[[3-(2-morpholin-4-ylethyl)-2-oxobenzimidazole-1-carbonyl]amino]butanimidoyl]-hydrazinylidene-methylazanium.
| Compound Name | [(2S)-3,3-dimethyl-2-[[3-(2-morpholin-4-ylethyl)-2-oxobenzimidazole-1-carbonyl]amino]butanimidoyl]-hydrazinylidene-methylazanium |
|---|---|
| PubChem CID | 143641847 |
| Molecular Formula | C21H33N8O3+ |
| Molecular Weight | 445.55 g/mol |
| Exact Mass | 445.27 |
| IUPAC Name | [(2S)-3,3-dimethyl-2-[[3-(2-morpholin-4-ylethyl)-2-oxobenzimidazole-1-carbonyl]amino]butanimidoyl]-hydrazinylidene-methylazanium |
| SMILES | [H]/N=C([C@@H](NC(=O)n1c(=O)n(CCN2CCOCC2)c2ccccc21)C(C)(C)C)\[N+](C)=N/N |
| InChI | InChI=1S/C21H32N8O3/c1-21(2,3)17(18(22)26(4)25-23)24-19(30)29-16-8-6-5-7-15(16)28(20(29)31)10-9-27-11-13-32-14-12-27/h5-8,17,22-23H,9-14H2,1-4H3,(H,24,30)/p+1/b22-18-/t17-/m1/s1 |
| InChIKey | DTXUYGLQLAKZIH-RTAFMGCNSA-O |
| XLogP | 1.05 |
| TPSA | 133.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.55 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|