C26H36N4O2 — CID 122367612
1-butyl-3-[5-[4-(4-hydroxyphenyl)piperazin-1-yl]pentyl]benzimidazol-2-one (PubChem CID 122367612) has the molecular formula C26H36N4O2 and a molecular weight of 436.60 g/mol. Its IUPAC name is 1-butyl-3-[5-[4-(4-hydroxyphenyl)piperazin-1-yl]pentyl]benzimidazol-2-one.
| Compound Name | 1-butyl-3-[5-[4-(4-hydroxyphenyl)piperazin-1-yl]pentyl]benzimidazol-2-one |
|---|---|
| PubChem CID | 122367612 |
| Molecular Formula | C26H36N4O2 |
| Molecular Weight | 436.60 g/mol |
| Exact Mass | 436.28 |
| IUPAC Name | 1-butyl-3-[5-[4-(4-hydroxyphenyl)piperazin-1-yl]pentyl]benzimidazol-2-one |
| SMILES | CCCCn1c(=O)n(CCCCCN2CCN(c3ccc(O)cc3)CC2)c2ccccc21 |
| InChI | InChI=1S/C26H36N4O2/c1-2-3-16-29-24-9-5-6-10-25(24)30(26(29)32)17-8-4-7-15-27-18-20-28(21-19-27)22-11-13-23(31)14-12-22/h5-6,9-14,31H,2-4,7-8,15-21H2,1H3 |
| InChIKey | ISJGATFMYZGSDU-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 53.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.60 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|