C24H31N5O2 — CID 27286571
N-[4-(4-ethylpiperazin-1-yl)phenyl]-2-(2-oxo-3-propylbenzimidazol-1-yl)acetamide (PubChem CID 27286571) has the molecular formula C24H31N5O2 and a molecular weight of 421.55 g/mol. Its IUPAC name is N-[4-(4-ethylpiperazin-1-yl)phenyl]-2-(2-oxo-3-propylbenzimidazol-1-yl)acetamide.
| Compound Name | N-[4-(4-ethylpiperazin-1-yl)phenyl]-2-(2-oxo-3-propylbenzimidazol-1-yl)acetamide |
|---|---|
| PubChem CID | 27286571 |
| Molecular Formula | C24H31N5O2 |
| Molecular Weight | 421.55 g/mol |
| Exact Mass | 421.25 |
| IUPAC Name | N-[4-(4-ethylpiperazin-1-yl)phenyl]-2-(2-oxo-3-propylbenzimidazol-1-yl)acetamide |
| SMILES | CCCn1c(=O)n(CC(=O)Nc2ccc(N3CCN(CC)CC3)cc2)c2ccccc21 |
| InChI | InChI=1S/C24H31N5O2/c1-3-13-28-21-7-5-6-8-22(21)29(24(28)31)18-23(30)25-19-9-11-20(12-10-19)27-16-14-26(4-2)15-17-27/h5-12H,3-4,13-18H2,1-2H3,(H,25,30) |
| InChIKey | JWWHLTGTBBNQNZ-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 62.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.55 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|