C23H30N4O3 — CID 9328434
3-[(3aR,7aR)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]-N-[4-(4-ethylpiperazin-1-yl)phenyl]propanamide (PubChem CID 9328434) has the molecular formula C23H30N4O3 and a molecular weight of 410.52 g/mol. Its IUPAC name is 3-[(3aR,7aR)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]-N-[4-(4-ethylpiperazin-1-yl)phenyl]propanamide.
| Compound Name | 3-[(3aR,7aR)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]-N-[4-(4-ethylpiperazin-1-yl)phenyl]propanamide |
|---|---|
| PubChem CID | 9328434 |
| Molecular Formula | C23H30N4O3 |
| Molecular Weight | 410.52 g/mol |
| Exact Mass | 410.23 |
| IUPAC Name | 3-[(3aR,7aR)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]-N-[4-(4-ethylpiperazin-1-yl)phenyl]propanamide |
| SMILES | CCN1CCN(c2ccc(NC(=O)CCN3C(=O)[C@@H]4CC=CC[C@H]4C3=O)cc2)CC1 |
| InChI | InChI=1S/C23H30N4O3/c1-2-25-13-15-26(16-14-25)18-9-7-17(8-10-18)24-21(28)11-12-27-22(29)19-5-3-4-6-20(19)23(27)30/h3-4,7-10,19-20H,2,5-6,11-16H2,1H3,(H,24,28)/t19-,20-/m1/s1 |
| InChIKey | YPRXMHOHPZQPNN-WOJBJXKFSA-N |
| XLogP | 2.11 |
| TPSA | 72.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.52 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|