C22H26ClN3O — CID 170868356
2-(4-chlorophenoxy)-1-methyl-3-(3-piperazin-1-ylpropyl)indole (PubChem CID 170868356) has the molecular formula C22H26ClN3O and a molecular weight of 383.92 g/mol. Its IUPAC name is 2-(4-chlorophenoxy)-1-methyl-3-(3-piperazin-1-ylpropyl)indole.
| Compound Name | 2-(4-chlorophenoxy)-1-methyl-3-(3-piperazin-1-ylpropyl)indole |
|---|---|
| PubChem CID | 170868356 |
| Molecular Formula | C22H26ClN3O |
| Molecular Weight | 383.92 g/mol |
| Exact Mass | 383.18 |
| IUPAC Name | 2-(4-chlorophenoxy)-1-methyl-3-(3-piperazin-1-ylpropyl)indole |
| SMILES | Cn1c(Oc2ccc(Cl)cc2)c(CCCN2CCNCC2)c2ccccc21 |
| InChI | InChI=1S/C22H26ClN3O/c1-25-21-7-3-2-5-19(21)20(6-4-14-26-15-12-24-13-16-26)22(25)27-18-10-8-17(23)9-11-18/h2-3,5,7-11,24H,4,6,12-16H2,1H3 |
| InChIKey | JUBNGYXMJVFSQW-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 29.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.92 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |