C17H24N2 — CID 79186198
N-[[2,3-dimethyl-1-(2-methylprop-2-enyl)indol-5-yl]methyl]ethanamine (PubChem CID 79186198) has the molecular formula C17H24N2 and a molecular weight of 256.39 g/mol. Its IUPAC name is N-[[2,3-dimethyl-1-(2-methylprop-2-enyl)indol-5-yl]methyl]ethanamine.
| Compound Name | N-[[2,3-dimethyl-1-(2-methylprop-2-enyl)indol-5-yl]methyl]ethanamine |
|---|---|
| PubChem CID | 79186198 |
| Molecular Formula | C17H24N2 |
| Molecular Weight | 256.39 g/mol |
| Exact Mass | 256.19 |
| IUPAC Name | N-[[2,3-dimethyl-1-(2-methylprop-2-enyl)indol-5-yl]methyl]ethanamine |
| SMILES | C=C(C)Cn1c(C)c(C)c2cc(CNCC)ccc21 |
| InChI | InChI=1S/C17H24N2/c1-6-18-10-15-7-8-17-16(9-15)13(4)14(5)19(17)11-12(2)3/h7-9,18H,2,6,10-11H2,1,3-5H3 |
| InChIKey | CLQBUZMLIRRSIW-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 16.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.39 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|