C19H20Cl2N2O3S3 — CID 100729659
N-[2-[(2,4-dichlorophenyl)methylsulfanyl]ethyl]-2-oxo-3-propan-2-yl-1,3-benzothiazole-6-sulfonamide (PubChem CID 100729659) has the molecular formula C19H20Cl2N2O3S3 and a molecular weight of 491.49 g/mol. Its IUPAC name is N-[2-[(2,4-dichlorophenyl)methylsulfanyl]ethyl]-2-oxo-3-propan-2-yl-1,3-benzothiazole-6-sulfonamide.
| Compound Name | N-[2-[(2,4-dichlorophenyl)methylsulfanyl]ethyl]-2-oxo-3-propan-2-yl-1,3-benzothiazole-6-sulfonamide |
|---|---|
| PubChem CID | 100729659 |
| Molecular Formula | C19H20Cl2N2O3S3 |
| Molecular Weight | 491.49 g/mol |
| Exact Mass | 490.00 |
| IUPAC Name | N-[2-[(2,4-dichlorophenyl)methylsulfanyl]ethyl]-2-oxo-3-propan-2-yl-1,3-benzothiazole-6-sulfonamide |
| SMILES | CC(C)n1c(=O)sc2cc(S(=O)(=O)NCCSCc3ccc(Cl)cc3Cl)ccc21 |
| InChI | InChI=1S/C19H20Cl2N2O3S3/c1-12(2)23-17-6-5-15(10-18(17)28-19(23)24)29(25,26)22-7-8-27-11-13-3-4-14(20)9-16(13)21/h3-6,9-10,12,22H,7-8,11H2,1-2H3 |
| InChIKey | FPANZICCIAXCPS-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 68.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.49 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|